About 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide
5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide (PubChem CID 146130844) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide |
| PubChem CID | 146130844 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide |
| SMILES | CCc1cc(C(=O)N[C@@H]2CCC(=O)N[C@H]2c2ccccc2)nn1C |
| InChI | InChI=1S/C18H22N4O2/c1-3-13-11-15(21-22(13)2)18(24)19-14-9-10-16(23)20-17(14)12-7-5-4-6-8-12/h4-8,11,14,17H,3,9-10H2,1-2H3,(H,19,24)(H,20,23)/t14-,17+/m1/s1 |
| InChIKey | VZCTXYWBXUZRGP-PBHICJAKSA-N |
| XLogP | 1.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide?
The IUPAC name of 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide (CID 146130844) is 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide.
What is the SMILES notation for 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide?
The canonical SMILES for 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide is CCc1cc(C(=O)N[C@@H]2CCC(=O)N[C@H]2c2ccccc2)nn1C.
What is the InChIKey of 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide?
The InChIKey is VZCTXYWBXUZRGP-PBHICJAKSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-3-13-11-15(21-22(13)2)18(24)19-14-9-10-16(23)20-17(14)12-7-5-4-6-8-12/h4-8,11,14,17H,3,9-10H2,1-2H3,(H,19,24)(H,20,23)/t14-,17+/m1/s1.
What are the key properties of 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide?
5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide has a molecular weight of 326.40 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-methyl-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyrazole-3-carboxamide is sourced from PubChem (CID 146130844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).