About 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide
4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide (PubChem CID 146130814) has the molecular formula C16H16ClN3O2
and a molecular weight of 317.78 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 146130814 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2cc(Cl)c[nH]2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C16H16ClN3O2/c17-11-8-13(18-9-11)16(22)19-12-6-7-14(21)20-15(12)10-4-2-1-3-5-10/h1-5,8-9,12,15,18H,6-7H2,(H,19,22)(H,20,21)/t12-,15+/m1/s1 |
| InChIKey | MCGKLQQODCKMTE-DOMZBBRYSA-N |
| XLogP | 2.42 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide (CID 146130814) is 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide is O=C1CC[C@@H](NC(=O)c2cc(Cl)c[nH]2)[C@H](c2ccccc2)N1.
What is the InChIKey of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide?
The InChIKey is MCGKLQQODCKMTE-DOMZBBRYSA-N. The full InChI is InChI=1S/C16H16ClN3O2/c17-11-8-13(18-9-11)16(22)19-12-6-7-14(21)20-15(12)10-4-2-1-3-5-10/h1-5,8-9,12,15,18H,6-7H2,(H,19,22)(H,20,21)/t12-,15+/m1/s1.
What are the key properties of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide?
4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide has a molecular weight of 317.78 g/mol, XLogP of 2.42, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 146130814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).