C16H16ClN3O2 — CID 146130814
4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide (PubChem CID 146130814) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146130814 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2cc(Cl)c[nH]2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C16H16ClN3O2/c17-11-8-13(18-9-11)16(22)19-12-6-7-14(21)20-15(12)10-4-2-1-3-5-10/h1-5,8-9,12,15,18H,6-7H2,(H,19,22)(H,20,21)/t12-,15+/m1/s1 |
| InChIKey | MCGKLQQODCKMTE-DOMZBBRYSA-N |
| XLogP | 2.42 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |