About 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide
4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide (PubChem CID 146147900) has the molecular formula C17H16ClN3O2
and a molecular weight of 329.79 g/mol. Its IUPAC name is 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide |
| PubChem CID | 146147900 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2cc(Cl)ccn2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-12-8-9-19-14(10-12)17(23)20-13-6-7-15(22)21-16(13)11-4-2-1-3-5-11/h1-5,8-10,13,16H,6-7H2,(H,20,23)(H,21,22)/t13-,16+/m1/s1 |
| InChIKey | VGLKQRVOGFENIF-CJNGLKHVSA-N |
| XLogP | 2.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide?
The IUPAC name of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide (CID 146147900) is 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide?
The canonical SMILES for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide is O=C1CC[C@@H](NC(=O)c2cc(Cl)ccn2)[C@H](c2ccccc2)N1.
What is the InChIKey of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide?
The InChIKey is VGLKQRVOGFENIF-CJNGLKHVSA-N. The full InChI is InChI=1S/C17H16ClN3O2/c18-12-8-9-19-14(10-12)17(23)20-13-6-7-15(22)21-16(13)11-4-2-1-3-5-11/h1-5,8-10,13,16H,6-7H2,(H,20,23)(H,21,22)/t13-,16+/m1/s1.
What are the key properties of 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide?
4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide has a molecular weight of 329.79 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(2S,3R)-6-oxo-2-phenylpiperidin-3-yl]pyridine-2-carboxamide is sourced from PubChem (CID 146147900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).