C19H19ClF3N3O3 — CID 146133721
(5R,6S)-5-[(2-chloro-3-pyridinyl)methylamino]-6-phenylpiperidin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 146133721) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is (5R,6S)-5-[(2-chloro-3-pyridinyl)methylamino]-6-phenylpiperidin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5R,6S)-5-[(2-chloro-3-pyridinyl)methylamino]-6-phenylpiperidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146133721 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (5R,6S)-5-[(2-chloro-3-pyridinyl)methylamino]-6-phenylpiperidin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CC[C@@H](NCc2cccnc2Cl)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C17H18ClN3O.C2HF3O2/c18-17-13(7-4-10-19-17)11-20-14-8-9-15(22)21-16(14)12-5-2-1-3-6-12;3-2(4,5)1(6)7/h1-7,10,14,16,20H,8-9,11H2,(H,21,22);(H,6,7)/t14-,16+;/m1./s1 |
| InChIKey | CHPGOZQZELGSGX-XMZRARIVSA-N |
| XLogP | 3.48 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|