C18H16ClFN2O2 — CID 95771187
4-chloro-2-fluoro-N-[(2R,3R)-6-oxo-2-phenylpiperidin-3-yl]benzamide (PubChem CID 95771187) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[(2R,3R)-6-oxo-2-phenylpiperidin-3-yl]benzamide.
| Compound Name | 4-chloro-2-fluoro-N-[(2R,3R)-6-oxo-2-phenylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 95771187 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-chloro-2-fluoro-N-[(2R,3R)-6-oxo-2-phenylpiperidin-3-yl]benzamide |
| SMILES | O=C1CC[C@@H](NC(=O)c2ccc(Cl)cc2F)C(c2ccccc2)N1 |
| InChI | InChI=1S/C18H16ClFN2O2/c19-12-6-7-13(14(20)10-12)18(24)21-15-8-9-16(23)22-17(15)11-4-2-1-3-5-11/h1-7,10,15,17H,8-9H2,(H,21,24)(H,22,23)/t15-,17?/m1/s1 |
| InChIKey | JPTRECGBKJWDOX-LDCVWXEPSA-N |
| XLogP | 3.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |