C17H19F2N3O2 — CID 138002370
(3-cyclobutylmorpholin-4-yl)-[2-(difluoromethyl)-3H-benzimidazol-5-yl]methanone (PubChem CID 138002370) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is (3-cyclobutylmorpholin-4-yl)-[2-(difluoromethyl)-3H-benzimidazol-5-yl]methanone.
| Compound Name | (3-cyclobutylmorpholin-4-yl)-[2-(difluoromethyl)-3H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 138002370 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (3-cyclobutylmorpholin-4-yl)-[2-(difluoromethyl)-3H-benzimidazol-5-yl]methanone |
| SMILES | O=C(c1ccc2nc(C(F)F)[nH]c2c1)N1CCOCC1C1CCC1 |
| InChI | InChI=1S/C17H19F2N3O2/c18-15(19)16-20-12-5-4-11(8-13(12)21-16)17(23)22-6-7-24-9-14(22)10-2-1-3-10/h4-5,8,10,14-15H,1-3,6-7,9H2,(H,20,21) |
| InChIKey | GIGICMLUIHUOJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |