C13H15ClN4O2 — CID 138004090
2-[(4-chlorophenyl)methyl-[(1-methyltriazol-4-yl)methyl]amino]acetic acid (PubChem CID 138004090) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[(1-methyltriazol-4-yl)methyl]amino]acetic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl-[(1-methyltriazol-4-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 138004090 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[(1-methyltriazol-4-yl)methyl]amino]acetic acid |
| SMILES | Cn1cc(CN(CC(=O)O)Cc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-17-7-12(15-16-17)8-18(9-13(19)20)6-10-2-4-11(14)5-3-10/h2-5,7H,6,8-9H2,1H3,(H,19,20) |
| InChIKey | LMJVCSVSYFVVLY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |