C17H29N3O2 — CID 138004890
N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-3-methyl-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 138004890) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-3-methyl-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-3-methyl-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138004890 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-(cyclohexylmethyl)-N-(2-hydroxyethyl)-3-methyl-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C(C)C)cc1C(=O)N(CCO)CC1CCCCC1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(2)20-12-16(14(3)18-20)17(22)19(9-10-21)11-15-7-5-4-6-8-15/h12-13,15,21H,4-11H2,1-3H3 |
| InChIKey | HGFPPMAVBCHRJB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |