C17H23ClN4O3 — CID 138013164
[(3aS,5S,6aS)-4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 138013164) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is [(3aS,5S,6aS)-4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aS,5S,6aS)-4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 138013164 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [(3aS,5S,6aS)-4-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1c(Cl)c(C(=O)N2[C@H](C(=O)N3CCCC3)C[C@@H]3OCC[C@@H]32)nn1C |
| InChI | InChI=1S/C17H23ClN4O3/c1-10-14(18)15(19-20(10)2)17(24)22-11-5-8-25-13(11)9-12(22)16(23)21-6-3-4-7-21/h11-13H,3-9H2,1-2H3/t11-,12-,13-/m0/s1 |
| InChIKey | CBQRNEGLHQARTO-AVGNSLFASA-N |
| XLogP | 1.38 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |