C14H16FN3O3 — CID 138013217
methyl 5-[(Z)-3-cyclopropyl-2-fluorobut-2-enoyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-4-carboxylate (PubChem CID 138013217) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is methyl 5-[(Z)-3-cyclopropyl-2-fluorobut-2-enoyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-4-carboxylate.
| Compound Name | methyl 5-[(Z)-3-cyclopropyl-2-fluorobut-2-enoyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 138013217 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | methyl 5-[(Z)-3-cyclopropyl-2-fluorobut-2-enoyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-4-carboxylate |
| SMILES | COC(=O)C1c2cn[nH]c2CN1C(=O)/C(F)=C(\C)C1CC1 |
| InChI | InChI=1S/C14H16FN3O3/c1-7(8-3-4-8)11(15)13(19)18-6-10-9(5-16-17-10)12(18)14(20)21-2/h5,8,12H,3-4,6H2,1-2H3,(H,16,17)/b11-7- |
| InChIKey | OZTDAHXZDYCMSQ-XFFZJAGNSA-N |
| XLogP | 1.62 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|