C13H21N5O4S — CID 138013292
3-acetamido-N-[2-(propan-2-ylsulfamoylamino)ethyl]pyridine-2-carboxamide (PubChem CID 138013292) has the molecular formula C13H21N5O4S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-acetamido-N-[2-(propan-2-ylsulfamoylamino)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-acetamido-N-[2-(propan-2-ylsulfamoylamino)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 138013292 |
| Molecular Formula | C13H21N5O4S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-acetamido-N-[2-(propan-2-ylsulfamoylamino)ethyl]pyridine-2-carboxamide |
| SMILES | CC(=O)Nc1cccnc1C(=O)NCCNS(=O)(=O)NC(C)C |
| InChI | InChI=1S/C13H21N5O4S/c1-9(2)18-23(21,22)16-8-7-15-13(20)12-11(17-10(3)19)5-4-6-14-12/h4-6,9,16,18H,7-8H2,1-3H3,(H,15,20)(H,17,19) |
| InChIKey | HWMWLBHMPVKBNK-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|