C16H17N5O4 — CID 138015009
3-methyl-4-nitro-N-[1-(2-oxo-1H-pyrazin-3-yl)pyrrolidin-3-yl]benzamide (PubChem CID 138015009) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-methyl-4-nitro-N-[1-(2-oxo-1H-pyrazin-3-yl)pyrrolidin-3-yl]benzamide.
| Compound Name | 3-methyl-4-nitro-N-[1-(2-oxo-1H-pyrazin-3-yl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 138015009 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-methyl-4-nitro-N-[1-(2-oxo-1H-pyrazin-3-yl)pyrrolidin-3-yl]benzamide |
| SMILES | Cc1cc(C(=O)NC2CCN(c3ncc[nH]c3=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N5O4/c1-10-8-11(2-3-13(10)21(24)25)15(22)19-12-4-7-20(9-12)14-16(23)18-6-5-17-14/h2-3,5-6,8,12H,4,7,9H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | MAJKPBMKIRYCSJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|