C15H23N3O3 — CID 138016433
2-(1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazin-9a-ylmethylamino)-1-pyridin-2-ylethanol (PubChem CID 138016433) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazin-9a-ylmethylamino)-1-pyridin-2-ylethanol.
| Compound Name | 2-(1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazin-9a-ylmethylamino)-1-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 138016433 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(1,3,4,6,7,9-hexahydro-[1,4]oxazino[3,4-c][1,4]oxazin-9a-ylmethylamino)-1-pyridin-2-ylethanol |
| SMILES | OC(CNCC12COCCN1CCOC2)c1ccccn1 |
| InChI | InChI=1S/C15H23N3O3/c19-14(13-3-1-2-4-17-13)9-16-10-15-11-20-7-5-18(15)6-8-21-12-15/h1-4,14,16,19H,5-12H2 |
| InChIKey | CMCQPZBWMGQOKX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |