C16H17ClFN3O2 — CID 138019424
1-[(3-chloro-2-methoxyphenyl)methyl]-3-[(1S)-1-(5-fluoro-3-pyridinyl)ethyl]urea (PubChem CID 138019424) has the molecular formula C16H17ClFN3O2 and a molecular weight of 337.78 g/mol. Its IUPAC name is 1-[(3-chloro-2-methoxyphenyl)methyl]-3-[(1S)-1-(5-fluoro-3-pyridinyl)ethyl]urea.
| Compound Name | 1-[(3-chloro-2-methoxyphenyl)methyl]-3-[(1S)-1-(5-fluoro-3-pyridinyl)ethyl]urea |
|---|---|
| PubChem CID | 138019424 |
| Molecular Formula | C16H17ClFN3O2 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[(3-chloro-2-methoxyphenyl)methyl]-3-[(1S)-1-(5-fluoro-3-pyridinyl)ethyl]urea |
| SMILES | COc1c(Cl)cccc1CNC(=O)N[C@@H](C)c1cncc(F)c1 |
| InChI | InChI=1S/C16H17ClFN3O2/c1-10(12-6-13(18)9-19-7-12)21-16(22)20-8-11-4-3-5-14(17)15(11)23-2/h3-7,9-10H,8H2,1-2H3,(H2,20,21,22)/t10-/m0/s1 |
| InChIKey | XGUXYRQGNGECFB-JTQLQIEISA-N |
| XLogP | 3.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |