C27H34ClN4O5Si — CID 156831702
CID 156831702 (PubChem CID 156831702) has the molecular formula C27H34ClN4O5Si and a molecular weight of 558.13 g/mol.
| Compound Name | CID 156831702 |
|---|---|
| PubChem CID | 156831702 |
| Molecular Formula | C27H34ClN4O5Si |
| Molecular Weight | 558.13 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | — |
| SMILES | CCC(NC(=O)[C@@]([Si])(CC(C)C)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1cccc(Cl)c1OC |
| InChI | InChI=1S/C27H34ClN4O5Si/c1-5-21(22(33)24(34)29-16-19-12-9-13-20(28)23(19)37-4)31-25(35)27(38,14-17(2)3)32-26(36)30-15-18-10-7-6-8-11-18/h6-13,17,21H,5,14-16H2,1-4H3,(H,29,34)(H,31,35)(H2,30,32,36)/t21?,27-/m0/s1 |
| InChIKey | USGBURBHCVMLAK-YQAGWJQESA-N |
| XLogP | 2.84 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.13 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|