C23H27FN4O5S — CID 156831758
3-[[2-(benzylcarbamoylamino)-2-sulfanylacetyl]amino]-N-[(3-fluoro-2-methoxyphenyl)methyl]-2-oxopentanamide (PubChem CID 156831758) has the molecular formula C23H27FN4O5S and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[[2-(benzylcarbamoylamino)-2-sulfanylacetyl]amino]-N-[(3-fluoro-2-methoxyphenyl)methyl]-2-oxopentanamide.
| Compound Name | 3-[[2-(benzylcarbamoylamino)-2-sulfanylacetyl]amino]-N-[(3-fluoro-2-methoxyphenyl)methyl]-2-oxopentanamide |
|---|---|
| PubChem CID | 156831758 |
| Molecular Formula | C23H27FN4O5S |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3-[[2-(benzylcarbamoylamino)-2-sulfanylacetyl]amino]-N-[(3-fluoro-2-methoxyphenyl)methyl]-2-oxopentanamide |
| SMILES | CCC(NC(=O)C(S)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1cccc(F)c1OC |
| InChI | InChI=1S/C23H27FN4O5S/c1-3-17(18(29)20(30)25-13-15-10-7-11-16(24)19(15)33-2)27-21(31)22(34)28-23(32)26-12-14-8-5-4-6-9-14/h4-11,17,22,34H,3,12-13H2,1-2H3,(H,25,30)(H,27,31)(H2,26,28,32) |
| InChIKey | IOCGQQILQOCJBU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|