C26H33BrN4O4 — CID 166709313
(2S)-2-(benzylcarbamoylamino)-N-[1-[(2-bromophenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide (PubChem CID 166709313) has the molecular formula C26H33BrN4O4 and a molecular weight of 545.48 g/mol. Its IUPAC name is (2S)-2-(benzylcarbamoylamino)-N-[1-[(2-bromophenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-(benzylcarbamoylamino)-N-[1-[(2-bromophenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 166709313 |
| Molecular Formula | C26H33BrN4O4 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (2S)-2-(benzylcarbamoylamino)-N-[1-[(2-bromophenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
| SMILES | CCC(NC(=O)[C@H](CC(C)C)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1ccccc1Br |
| InChI | InChI=1S/C26H33BrN4O4/c1-4-21(23(32)25(34)28-16-19-12-8-9-13-20(19)27)30-24(33)22(14-17(2)3)31-26(35)29-15-18-10-6-5-7-11-18/h5-13,17,21-22H,4,14-16H2,1-3H3,(H,28,34)(H,30,33)(H2,29,31,35)/t21?,22-/m0/s1 |
| InChIKey | DDLJUXPGMXAOCD-KEKNWZKVSA-N |
| XLogP | 3.44 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|