C28H36N6O4 — CID 166709412
(2S)-2-(benzylcarbamoylamino)-4-methyl-N-[1-[(1-methylbenzimidazol-5-yl)methylamino]-1,2-dioxopentan-3-yl]pentanamide (PubChem CID 166709412) has the molecular formula C28H36N6O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is (2S)-2-(benzylcarbamoylamino)-4-methyl-N-[1-[(1-methylbenzimidazol-5-yl)methylamino]-1,2-dioxopentan-3-yl]pentanamide.
| Compound Name | (2S)-2-(benzylcarbamoylamino)-4-methyl-N-[1-[(1-methylbenzimidazol-5-yl)methylamino]-1,2-dioxopentan-3-yl]pentanamide |
|---|---|
| PubChem CID | 166709412 |
| Molecular Formula | C28H36N6O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2S)-2-(benzylcarbamoylamino)-4-methyl-N-[1-[(1-methylbenzimidazol-5-yl)methylamino]-1,2-dioxopentan-3-yl]pentanamide |
| SMILES | CCC(NC(=O)[C@H](CC(C)C)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C28H36N6O4/c1-5-21(25(35)27(37)29-16-20-11-12-24-22(14-20)31-17-34(24)4)32-26(36)23(13-18(2)3)33-28(38)30-15-19-9-7-6-8-10-19/h6-12,14,17-18,21,23H,5,13,15-16H2,1-4H3,(H,29,37)(H,32,36)(H2,30,33,38)/t21?,23-/m0/s1 |
| InChIKey | PZWCOIVPDXWZPO-YANBTOMASA-N |
| XLogP | 2.57 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|