C26H35N5O6 — CID 166709308
N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methyl-2-(pyridin-3-ylcarbamoylamino)pentanamide (PubChem CID 166709308) has the molecular formula C26H35N5O6 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methyl-2-(pyridin-3-ylcarbamoylamino)pentanamide.
| Compound Name | N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methyl-2-(pyridin-3-ylcarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 166709308 |
| Molecular Formula | C26H35N5O6 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methyl-2-(pyridin-3-ylcarbamoylamino)pentanamide |
| SMILES | CCC(NC(=O)C(CC(C)C)NC(=O)Nc1cccnc1)C(=O)C(=O)NCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H35N5O6/c1-6-21(23(32)25(34)28-14-17-11-19(36-4)13-20(12-17)37-5)30-24(33)22(10-16(2)3)31-26(35)29-18-8-7-9-27-15-18/h7-9,11-13,15-16,21-22H,6,10,14H2,1-5H3,(H,28,34)(H,30,33)(H2,29,31,35) |
| InChIKey | HYVDQLOZPZXZDS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|