C30H41N5O7 — CID 166719658
(2S)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-2-[(4-methanimidoyl-2-methoxyphenyl)methylcarbamoylamino]-4-methylpentanamide (PubChem CID 166719658) has the molecular formula C30H41N5O7 and a molecular weight of 583.69 g/mol. Its IUPAC name is (2S)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-2-[(4-methanimidoyl-2-methoxyphenyl)methylcarbamoylamino]-4-methylpentanamide.
| Compound Name | (2S)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-2-[(4-methanimidoyl-2-methoxyphenyl)methylcarbamoylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 166719658 |
| Molecular Formula | C30H41N5O7 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | (2S)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-2-[(4-methanimidoyl-2-methoxyphenyl)methylcarbamoylamino]-4-methylpentanamide |
| SMILES | [H]/N=C/c1ccc(CNC(=O)N[C@@H](CC(C)C)C(=O)NC(CC)C(=O)C(=O)NCc2cc(OC)cc(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C30H41N5O7/c1-7-24(27(36)29(38)32-16-20-11-22(40-4)14-23(12-20)41-5)34-28(37)25(10-18(2)3)35-30(39)33-17-21-9-8-19(15-31)13-26(21)42-6/h8-9,11-15,18,24-25,31H,7,10,16-17H2,1-6H3,(H,32,38)(H,34,37)(H2,33,35,39)/b31-15+/t24?,25-/m0/s1 |
| InChIKey | BUKSRLZRJRSUOU-LJIKABMTSA-N |
| XLogP | 2.70 |
| TPSA | 167.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|