C20H31N3O5 — CID 156831725
(2S)-2-amino-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide (PubChem CID 156831725) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 156831725 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2S)-2-amino-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
| SMILES | CCC(NC(=O)[C@@H](N)CC(C)C)C(=O)C(=O)NCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C20H31N3O5/c1-6-17(23-19(25)16(21)7-12(2)3)18(24)20(26)22-11-13-8-14(27-4)10-15(9-13)28-5/h8-10,12,16-17H,6-7,11,21H2,1-5H3,(H,22,26)(H,23,25)/t16-,17?/m0/s1 |
| InChIKey | BOVUCNPRRXUSAV-BHWOMJMDSA-N |
| XLogP | 1.16 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|