C26H38N4O6 — CID 178040950
(2Z)-2-(cyclopentylcarbamoylimino)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide (PubChem CID 178040950) has the molecular formula C26H38N4O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2Z)-2-(cyclopentylcarbamoylimino)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide.
| Compound Name | (2Z)-2-(cyclopentylcarbamoylimino)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 178040950 |
| Molecular Formula | C26H38N4O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (2Z)-2-(cyclopentylcarbamoylimino)-N-[1-[(3,5-dimethoxyphenyl)methylamino]-1,2-dioxopentan-3-yl]-4-methylpentanamide |
| SMILES | CCC(NC(=O)/C(CC(C)C)=N\C(=O)NC1CCCC1)C(=O)C(=O)NCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H38N4O6/c1-6-21(23(31)25(33)27-15-17-12-19(35-4)14-20(13-17)36-5)29-24(32)22(11-16(2)3)30-26(34)28-18-9-7-8-10-18/h12-14,16,18,21H,6-11,15H2,1-5H3,(H,27,33)(H,28,34)(H,29,32)/b30-22- |
| InChIKey | CAPONGJIEUIWBV-SWKFRHMKSA-N |
| XLogP | 2.92 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|