C26H33N5O6 — CID 166709312
2-(benzylcarbamoylamino)-4-methyl-N-[1-[(2-nitrophenyl)methylamino]-1,2-dioxopentan-3-yl]pentanamide (PubChem CID 166709312) has the molecular formula C26H33N5O6 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-4-methyl-N-[1-[(2-nitrophenyl)methylamino]-1,2-dioxopentan-3-yl]pentanamide.
| Compound Name | 2-(benzylcarbamoylamino)-4-methyl-N-[1-[(2-nitrophenyl)methylamino]-1,2-dioxopentan-3-yl]pentanamide |
|---|---|
| PubChem CID | 166709312 |
| Molecular Formula | C26H33N5O6 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-(benzylcarbamoylamino)-4-methyl-N-[1-[(2-nitrophenyl)methylamino]-1,2-dioxopentan-3-yl]pentanamide |
| SMILES | CCC(NC(=O)C(CC(C)C)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33N5O6/c1-4-20(23(32)25(34)27-16-19-12-8-9-13-22(19)31(36)37)29-24(33)21(14-17(2)3)30-26(35)28-15-18-10-6-5-7-11-18/h5-13,17,20-21H,4,14-16H2,1-3H3,(H,27,34)(H,29,33)(H2,28,30,35) |
| InChIKey | UNOXDGQDTPELKY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|