C26H32BrN4O4Si — CID 156831735
CID 156831735 (PubChem CID 156831735) has the molecular formula C26H32BrN4O4Si and a molecular weight of 572.56 g/mol.
| Compound Name | CID 156831735 |
|---|---|
| PubChem CID | 156831735 |
| Molecular Formula | C26H32BrN4O4Si |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | — |
| SMILES | CCC(NC(=O)[C@@]([Si])(CC(C)C)NC(=O)NCc1ccccc1)C(=O)C(=O)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H32BrN4O4Si/c1-4-21(22(32)23(33)28-15-19-10-12-20(27)13-11-19)30-24(34)26(36,14-17(2)3)31-25(35)29-16-18-8-6-5-7-9-18/h5-13,17,21H,4,14-16H2,1-3H3,(H,28,33)(H,30,34)(H2,29,31,35)/t21?,26-/m0/s1 |
| InChIKey | HGEDEZGKTYTTIM-UQTORGHUSA-N |
| XLogP | 2.94 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|