C16H23NO4S — CID 138021737
N-(2,2-dimethyl-1,1-dioxothian-4-yl)-2-(2-methylphenoxy)acetamide (PubChem CID 138021737) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,1-dioxothian-4-yl)-2-(2-methylphenoxy)acetamide.
| Compound Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 138021737 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1ccccc1OCC(=O)NC1CCS(=O)(=O)C(C)(C)C1 |
| InChI | InChI=1S/C16H23NO4S/c1-12-6-4-5-7-14(12)21-11-15(18)17-13-8-9-22(19,20)16(2,3)10-13/h4-7,13H,8-11H2,1-3H3,(H,17,18) |
| InChIKey | ZYNQASMPWLSVCU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |