C15H16N6O — CID 138023137
6-methyl-4-[(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-ylamino)methyl]-1H-pyridin-2-one (PubChem CID 138023137) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-methyl-4-[(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-ylamino)methyl]-1H-pyridin-2-one.
| Compound Name | 6-methyl-4-[(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-ylamino)methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 138023137 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-methyl-4-[(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-ylamino)methyl]-1H-pyridin-2-one |
| SMILES | Cc1cc(CNc2c3c(nc4ncnn24)CCC3)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H16N6O/c1-9-5-10(6-13(22)19-9)7-16-14-11-3-2-4-12(11)20-15-17-8-18-21(14)15/h5-6,8,16H,2-4,7H2,1H3,(H,19,22) |
| InChIKey | KOHXEBPJSUKZJV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |