C14H13N5 — CID 645556
N-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 645556) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 645556 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | c1ccc(Nc2c3c(nc4ncnn24)CCC3)cc1 |
| InChI | InChI=1S/C14H13N5/c1-2-5-10(6-3-1)17-13-11-7-4-8-12(11)18-14-15-9-16-19(13)14/h1-3,5-6,9,17H,4,7-8H2 |
| InChIKey | BHQOPFYUFKOKPW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |