C19H22N6O — CID 43816924
2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 43816924) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 43816924 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | COc1ccc(N2CCN(c3c4c(nc5ncnn35)CCC4)CC2)cc1 |
| InChI | InChI=1S/C19H22N6O/c1-26-15-7-5-14(6-8-15)23-9-11-24(12-10-23)18-16-3-2-4-17(16)22-19-20-13-21-25(18)19/h5-8,13H,2-4,9-12H2,1H3 |
| InChIKey | JGIVAUSBTDSOOL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|