C16H17N5O2 — CID 44753836
N-(3,5-dimethoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 44753836) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 44753836 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | COc1cc(Nc2c3c(nc4ncnn24)CCC3)cc(OC)c1 |
| InChI | InChI=1S/C16H17N5O2/c1-22-11-6-10(7-12(8-11)23-2)19-15-13-4-3-5-14(13)20-16-17-9-18-21(15)16/h6-9,19H,3-5H2,1-2H3 |
| InChIKey | LTUCDMGKXNOKEN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |