C20H21N9O — CID 66498872
3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-methyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine (PubChem CID 66498872) has the molecular formula C20H21N9O and a molecular weight of 403.45 g/mol. Its IUPAC name is 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-methyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine.
| Compound Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-methyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 66498872 |
| Molecular Formula | C20H21N9O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]-4-methyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
| SMILES | COc1ccc(N2CCN(c3nccc(-c4nnc5ncnn5c4C)n3)CC2)cc1 |
| InChI | InChI=1S/C20H21N9O/c1-14-18(25-26-20-22-13-23-29(14)20)17-7-8-21-19(24-17)28-11-9-27(10-12-28)15-3-5-16(30-2)6-4-15/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | IVNJNCSZDYFARE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 97.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|