C16H20N8 — CID 66498881
4,7-dimethyl-3-[2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-[1,2,4]triazolo[5,1-c][1,2,4]triazine (PubChem CID 66498881) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is 4,7-dimethyl-3-[2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-[1,2,4]triazolo[5,1-c][1,2,4]triazine.
| Compound Name | 4,7-dimethyl-3-[2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 66498881 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4,7-dimethyl-3-[2-(4-methylpiperidin-1-yl)pyrimidin-4-yl]-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
| SMILES | Cc1nc2nnc(-c3ccnc(N4CCC(C)CC4)n3)c(C)n2n1 |
| InChI | InChI=1S/C16H20N8/c1-10-5-8-23(9-6-10)15-17-7-4-13(19-15)14-11(2)24-16(21-20-14)18-12(3)22-24/h4,7,10H,5-6,8-9H2,1-3H3 |
| InChIKey | YKXKGITZVJTUFM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |