C22H24N8 — CID 66499036
3-[2-(3,5-dimethylpiperidin-1-yl)pyrimidin-4-yl]-4-methyl-7-phenyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine (PubChem CID 66499036) has the molecular formula C22H24N8 and a molecular weight of 400.49 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylpiperidin-1-yl)pyrimidin-4-yl]-4-methyl-7-phenyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine.
| Compound Name | 3-[2-(3,5-dimethylpiperidin-1-yl)pyrimidin-4-yl]-4-methyl-7-phenyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 66499036 |
| Molecular Formula | C22H24N8 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[2-(3,5-dimethylpiperidin-1-yl)pyrimidin-4-yl]-4-methyl-7-phenyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
| SMILES | Cc1c(-c2ccnc(N3CC(C)CC(C)C3)n2)nnc2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C22H24N8/c1-14-11-15(2)13-29(12-14)21-23-10-9-18(24-21)19-16(3)30-22(27-26-19)25-20(28-30)17-7-5-4-6-8-17/h4-10,14-15H,11-13H2,1-3H3 |
| InChIKey | QWXLTULVCAZCFF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |