C19H18N8S — CID 66499157
4-methyl-3-[2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]-7-methylsulfanyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine (PubChem CID 66499157) has the molecular formula C19H18N8S and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-methyl-3-[2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]-7-methylsulfanyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine.
| Compound Name | 4-methyl-3-[2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]-7-methylsulfanyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 66499157 |
| Molecular Formula | C19H18N8S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-methyl-3-[2-(2-methyl-2,3-dihydroindol-1-yl)pyrimidin-4-yl]-7-methylsulfanyl-[1,2,4]triazolo[5,1-c][1,2,4]triazine |
| SMILES | CSc1nc2nnc(-c3ccnc(N4c5ccccc5CC4C)n3)c(C)n2n1 |
| InChI | InChI=1S/C19H18N8S/c1-11-10-13-6-4-5-7-15(13)26(11)17-20-9-8-14(21-17)16-12(2)27-18(24-23-16)22-19(25-27)28-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | BWHFIPYZBFRSKE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |