C19H16N4O2 — CID 66493749
2-methyl-1-[4-(4-nitrophenyl)pyrimidin-2-yl]-2,3-dihydroindole (PubChem CID 66493749) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-nitrophenyl)pyrimidin-2-yl]-2,3-dihydroindole.
| Compound Name | 2-methyl-1-[4-(4-nitrophenyl)pyrimidin-2-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 66493749 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-methyl-1-[4-(4-nitrophenyl)pyrimidin-2-yl]-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1c1nccc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H16N4O2/c1-13-12-15-4-2-3-5-18(15)22(13)19-20-11-10-17(21-19)14-6-8-16(9-7-14)23(24)25/h2-11,13H,12H2,1H3 |
| InChIKey | IHBWNSKOTUZPOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|