C15H13ClN2O2 — CID 104838682
1-(3-chloro-2-nitrophenyl)-2-methyl-2,3-dihydroindole (PubChem CID 104838682) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 1-(3-chloro-2-nitrophenyl)-2-methyl-2,3-dihydroindole.
| Compound Name | 1-(3-chloro-2-nitrophenyl)-2-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 104838682 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-(3-chloro-2-nitrophenyl)-2-methyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13ClN2O2/c1-10-9-11-5-2-3-7-13(11)17(10)14-8-4-6-12(16)15(14)18(19)20/h2-8,10H,9H2,1H3 |
| InChIKey | ICJAEDHDBPQMNI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|