C22H26N6O — CID 43816956
N-(2-phenylethyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-4-carboxamide (PubChem CID 43816956) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is N-(2-phenylethyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-phenylethyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43816956 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | N-(2-phenylethyl)-1-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCN(c2c3c(nc4ncnn24)CCC3)CC1 |
| InChI | InChI=1S/C22H26N6O/c29-20(23-12-9-16-5-2-1-3-6-16)17-10-13-27(14-11-17)21-18-7-4-8-19(18)26-22-24-15-25-28(21)22/h1-3,5-6,15,17H,4,7-14H2,(H,23,29) |
| InChIKey | BUGAFHGZAUJKGM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |