C17H18N6O2 — CID 3227201
furan-2-yl-[4-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperazin-1-yl]methanone (PubChem CID 3227201) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is furan-2-yl-[4-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3227201 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | furan-2-yl-[4-(1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(c2c3c(nc4ncnn24)CCC3)CC1 |
| InChI | InChI=1S/C17H18N6O2/c24-16(14-5-2-10-25-14)22-8-6-21(7-9-22)15-12-3-1-4-13(12)20-17-18-11-19-23(15)17/h2,5,10-11H,1,3-4,6-9H2 |
| InChIKey | HYSJLIFPXNIPIE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |