C11H20N2O5S2 — CID 138024462
2-cyclopropylsulfonyl-1-(4-ethylsulfonylpiperazin-1-yl)ethanone (PubChem CID 138024462) has the molecular formula C11H20N2O5S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-cyclopropylsulfonyl-1-(4-ethylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-cyclopropylsulfonyl-1-(4-ethylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 138024462 |
| Molecular Formula | C11H20N2O5S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-cyclopropylsulfonyl-1-(4-ethylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CCS(=O)(=O)N1CCN(C(=O)CS(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C11H20N2O5S2/c1-2-20(17,18)13-7-5-12(6-8-13)11(14)9-19(15,16)10-3-4-10/h10H,2-9H2,1H3 |
| InChIKey | HTYMJTTXZNBIOF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |