C17H25N3O3 — CID 138029837
1-N-(3-butan-2-ylphenyl)-4-hydroxypiperidine-1,4-dicarboxamide (PubChem CID 138029837) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-N-(3-butan-2-ylphenyl)-4-hydroxypiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(3-butan-2-ylphenyl)-4-hydroxypiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 138029837 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-N-(3-butan-2-ylphenyl)-4-hydroxypiperidine-1,4-dicarboxamide |
| SMILES | CCC(C)c1cccc(NC(=O)N2CCC(O)(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-12(2)13-5-4-6-14(11-13)19-16(22)20-9-7-17(23,8-10-20)15(18)21/h4-6,11-12,23H,3,7-10H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | SDUADKMKTLEBET-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |