C19H20N2O2 — CID 138030908
(2R,3R)-N-(2,3-dihydro-1H-indol-4-yl)-2-phenyloxolane-3-carboxamide (PubChem CID 138030908) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2R,3R)-N-(2,3-dihydro-1H-indol-4-yl)-2-phenyloxolane-3-carboxamide.
| Compound Name | (2R,3R)-N-(2,3-dihydro-1H-indol-4-yl)-2-phenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 138030908 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2R,3R)-N-(2,3-dihydro-1H-indol-4-yl)-2-phenyloxolane-3-carboxamide |
| SMILES | O=C(Nc1cccc2c1CCN2)[C@@H]1CCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c22-19(21-17-8-4-7-16-14(17)9-11-20-16)15-10-12-23-18(15)13-5-2-1-3-6-13/h1-8,15,18,20H,9-12H2,(H,21,22)/t15-,18+/m1/s1 |
| InChIKey | ZDUXYASMLRXOJD-QAPCUYQASA-N |
| XLogP | 3.37 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |