C16H22N2O2 — CID 65154594
3-(oxolan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-5-yl)propanamide (PubChem CID 65154594) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-5-yl)propanamide.
| Compound Name | 3-(oxolan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-5-yl)propanamide |
|---|---|
| PubChem CID | 65154594 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3-(oxolan-2-yl)-N-(1,2,3,4-tetrahydroquinolin-5-yl)propanamide |
| SMILES | O=C(CCC1CCCO1)Nc1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H22N2O2/c19-16(9-8-12-4-3-11-20-12)18-15-7-1-6-14-13(15)5-2-10-17-14/h1,6-7,12,17H,2-5,8-11H2,(H,18,19) |
| InChIKey | LXNODMKIQGQSPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |