C14H21N3O — CID 79161957
1,1-diethyl-3-(1,2,3,4-tetrahydroquinolin-5-yl)urea (PubChem CID 79161957) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1,1-diethyl-3-(1,2,3,4-tetrahydroquinolin-5-yl)urea.
| Compound Name | 1,1-diethyl-3-(1,2,3,4-tetrahydroquinolin-5-yl)urea |
|---|---|
| PubChem CID | 79161957 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1,1-diethyl-3-(1,2,3,4-tetrahydroquinolin-5-yl)urea |
| SMILES | CCN(CC)C(=O)Nc1cccc2c1CCCN2 |
| InChI | InChI=1S/C14H21N3O/c1-3-17(4-2)14(18)16-13-9-5-8-12-11(13)7-6-10-15-12/h5,8-9,15H,3-4,6-7,10H2,1-2H3,(H,16,18) |
| InChIKey | WCBPYFJWOCDOON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |