C16H15ClN2O2 — CID 106500914
2-chloro-5-hydroxy-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide (PubChem CID 106500914) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-chloro-5-hydroxy-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide.
| Compound Name | 2-chloro-5-hydroxy-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide |
|---|---|
| PubChem CID | 106500914 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-chloro-5-hydroxy-N-(1,2,3,4-tetrahydroquinolin-5-yl)benzamide |
| SMILES | O=C(Nc1cccc2c1CCCN2)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C16H15ClN2O2/c17-13-7-6-10(20)9-12(13)16(21)19-15-5-1-4-14-11(15)3-2-8-18-14/h1,4-7,9,18,20H,2-3,8H2,(H,19,21) |
| InChIKey | TZNXBSCZHGQWMR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |