C18H26N2O3 — CID 94642296
N-tert-butyl-2-[3-[(2S)-oxolan-2-yl]propanoylamino]benzamide (PubChem CID 94642296) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-tert-butyl-2-[3-[(2S)-oxolan-2-yl]propanoylamino]benzamide.
| Compound Name | N-tert-butyl-2-[3-[(2S)-oxolan-2-yl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 94642296 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-tert-butyl-2-[3-[(2S)-oxolan-2-yl]propanoylamino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NC(=O)CC[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2,3)20-17(22)14-8-4-5-9-15(14)19-16(21)11-10-13-7-6-12-23-13/h4-5,8-9,13H,6-7,10-12H2,1-3H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | XCZWTEFSFYKWDL-ZDUSSCGKSA-N |
| XLogP | 3.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |