C15H19ClF3N3O — CID 138036709
(4-chloro-1-ethylpyrazol-5-yl)-[9-(trifluoromethyl)-6-azaspiro[3.5]nonan-6-yl]methanone (PubChem CID 138036709) has the molecular formula C15H19ClF3N3O and a molecular weight of 349.78 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-[9-(trifluoromethyl)-6-azaspiro[3.5]nonan-6-yl]methanone.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-[9-(trifluoromethyl)-6-azaspiro[3.5]nonan-6-yl]methanone |
|---|---|
| PubChem CID | 138036709 |
| Molecular Formula | C15H19ClF3N3O |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-[9-(trifluoromethyl)-6-azaspiro[3.5]nonan-6-yl]methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CCC(C(F)(F)F)C2(CCC2)C1 |
| InChI | InChI=1S/C15H19ClF3N3O/c1-2-22-12(10(16)8-20-22)13(23)21-7-4-11(15(17,18)19)14(9-21)5-3-6-14/h8,11H,2-7,9H2,1H3 |
| InChIKey | YVUHEWPXPLISDA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |