C15H17ClN4O3 — CID 4581379
[4-(4-chloro-1-ethylpyrazole-5-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 4581379) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is [4-(4-chloro-1-ethylpyrazole-5-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(4-chloro-1-ethylpyrazole-5-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 4581379 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [4-(4-chloro-1-ethylpyrazole-5-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C15H17ClN4O3/c1-2-20-13(11(16)10-17-20)15(22)19-7-5-18(6-8-19)14(21)12-4-3-9-23-12/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | DPOJLJLXVAOSLB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |