About (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone
(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone (PubChem CID 138038323) has the molecular formula C21H22ClNO2
and a molecular weight of 355.87 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone.
Molecular Properties
| Compound Name | (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone |
| PubChem CID | 138038323 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(C2CCCOC2)cc1)N1CCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H22ClNO2/c22-19-9-10-20-17(13-19)3-1-11-23(20)21(24)16-7-5-15(6-8-16)18-4-2-12-25-14-18/h5-10,13,18H,1-4,11-12,14H2 |
| InChIKey | BFASSCOHYPTUPD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone?
The IUPAC name of (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone (CID 138038323) is (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone.
What is the SMILES notation for (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone?
The canonical SMILES for (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone is O=C(c1ccc(C2CCCOC2)cc1)N1CCCc2cc(Cl)ccc21.
What is the InChIKey of (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone?
The InChIKey is BFASSCOHYPTUPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClNO2/c22-19-9-10-20-17(13-19)3-1-11-23(20)21(24)16-7-5-15(6-8-16)18-4-2-12-25-14-18/h5-10,13,18H,1-4,11-12,14H2.
What are the key properties of (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone?
(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone has a molecular weight of 355.87 g/mol, XLogP of 4.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3,4-dihydro-2H-quinolin-1-yl)-[4-(oxan-3-yl)phenyl]methanone is sourced from PubChem (CID 138038323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).