C19H24N4O — CID 138038412
N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 138038412) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 138038412 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CC1CN(c2ccc(Nc3ncnc4c3CCC4)cc2)CC(C)O1 |
| InChI | InChI=1S/C19H24N4O/c1-13-10-23(11-14(2)24-13)16-8-6-15(7-9-16)22-19-17-4-3-5-18(17)20-12-21-19/h6-9,12-14H,3-5,10-11H2,1-2H3,(H,20,21,22) |
| InChIKey | SVGZVYDOINKGKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|