C7H7ClO4S2 — CID 138039734
5-(1,3-dioxolan-2-yl)thiophene-3-sulfonyl chloride (PubChem CID 138039734) has the molecular formula C7H7ClO4S2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)thiophene-3-sulfonyl chloride.
| Compound Name | 5-(1,3-dioxolan-2-yl)thiophene-3-sulfonyl chloride |
|---|---|
| PubChem CID | 138039734 |
| Molecular Formula | C7H7ClO4S2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)thiophene-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1csc(C2OCCO2)c1 |
| InChI | InChI=1S/C7H7ClO4S2/c8-14(9,10)5-3-6(13-4-5)7-11-1-2-12-7/h3-4,7H,1-2H2 |
| InChIKey | MNNTXNSTMRXHOY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |