C9H16O3 — CID 138040312
2-(3,3-dimethyloxan-2-yl)acetic acid (PubChem CID 138040312) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-(3,3-dimethyloxan-2-yl)acetic acid.
| Compound Name | 2-(3,3-dimethyloxan-2-yl)acetic acid |
|---|---|
| PubChem CID | 138040312 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-(3,3-dimethyloxan-2-yl)acetic acid |
| SMILES | CC1(C)CCCOC1CC(=O)O |
| InChI | InChI=1S/C9H16O3/c1-9(2)4-3-5-12-7(9)6-8(10)11/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | USNMHWNWOFHPTG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |